C30H58O4Si — CID 159007452
tert-butyl-dimethyl-[(2S,3R)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-enyl]oxiran-2-yl]pentan-3-yl]oxysilane;(2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-enyl]oxiran-2-yl]pentan-3-ol (PubChem CID 159007452) has the molecular formula C30H58O4Si and a molecular weight of 510.88 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S,3R)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-enyl]oxiran-2-yl]pentan-3-yl]oxysilane;(2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-enyl]oxiran-2-yl]pentan-3-ol.
| Compound Name | tert-butyl-dimethyl-[(2S,3R)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-enyl]oxiran-2-yl]pentan-3-yl]oxysilane;(2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-enyl]oxiran-2-yl]pentan-3-ol |
|---|---|
| PubChem CID | 159007452 |
| Molecular Formula | C30H58O4Si |
| Molecular Weight | 510.88 g/mol |
| Exact Mass | 510.41 |
| IUPAC Name | tert-butyl-dimethyl-[(2S,3R)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-enyl]oxiran-2-yl]pentan-3-yl]oxysilane;(2R,3S)-2-[(2R,3R)-3-[(2S)-2-methylbut-3-enyl]oxiran-2-yl]pentan-3-ol |
| SMILES | C=C[C@@H](C)C[C@H]1O[C@@H]1[C@H](C)[C@@H](CC)O[Si](C)(C)C(C)(C)C.C=C[C@@H](C)C[C@H]1O[C@@H]1[C@H](C)[C@@H](O)CC |
| InChI | InChI=1S/C18H36O2Si.C12H22O2/c1-10-13(3)12-16-17(19-16)14(4)15(11-2)20-21(8,9)18(5,6)7;1-5-8(3)7-11-12(14-11)9(4)10(13)6-2/h10,13-17H,1,11-12H2,2-9H3;5,8-13H,1,6-7H2,2-4H3/t13-,14-,15-,16-,17-;8-,9-,10+,11-,12-/m11/s1 |
| InChIKey | JSCDNVPDXHCVLH-ZOQWMZPUSA-N |
| XLogP | 7.78 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.88 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|