C12H20O3 — CID 171561778
(2R,3S)-2-[(2R,3R)-3-[(2R)-2-hydroxy-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol (PubChem CID 171561778) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (2R,3S)-2-[(2R,3R)-3-[(2R)-2-hydroxy-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol.
| Compound Name | (2R,3S)-2-[(2R,3R)-3-[(2R)-2-hydroxy-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol |
|---|---|
| PubChem CID | 171561778 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (2R,3S)-2-[(2R,3R)-3-[(2R)-2-hydroxy-2-methylbut-3-ynyl]oxiran-2-yl]pentan-3-ol |
| SMILES | C#C[C@](C)(O)C[C@H]1O[C@@H]1[C@H](C)[C@@H](O)CC |
| InChI | InChI=1S/C12H20O3/c1-5-9(13)8(3)11-10(15-11)7-12(4,14)6-2/h2,8-11,13-14H,5,7H2,1,3-4H3/t8-,9+,10-,11-,12+/m1/s1 |
| InChIKey | GPVIJADTCHFMFJ-ROHXPCBUSA-N |
| XLogP | 0.94 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|