C24H50O6Si — CID 10623941
tert-butyl-[(3R,4R,5R,6R,9S)-9-methoxy-3,5-bis(methoxymethoxy)-4,6-dimethylundec-10-enoxy]-dimethylsilane (PubChem CID 10623941) has the molecular formula C24H50O6Si and a molecular weight of 462.74 g/mol. Its IUPAC name is tert-butyl-[(3R,4R,5R,6R,9S)-9-methoxy-3,5-bis(methoxymethoxy)-4,6-dimethylundec-10-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4R,5R,6R,9S)-9-methoxy-3,5-bis(methoxymethoxy)-4,6-dimethylundec-10-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10623941 |
| Molecular Formula | C24H50O6Si |
| Molecular Weight | 462.74 g/mol |
| Exact Mass | 462.34 |
| IUPAC Name | tert-butyl-[(3R,4R,5R,6R,9S)-9-methoxy-3,5-bis(methoxymethoxy)-4,6-dimethylundec-10-enoxy]-dimethylsilane |
| SMILES | C=C[C@H](CC[C@@H](C)[C@@H](OCOC)[C@H](C)[C@@H](CCO[Si](C)(C)C(C)(C)C)OCOC)OC |
| InChI | InChI=1S/C24H50O6Si/c1-12-21(27-9)14-13-19(2)23(29-18-26-8)20(3)22(28-17-25-7)15-16-30-31(10,11)24(4,5)6/h12,19-23H,1,13-18H2,2-11H3/t19-,20-,21-,22-,23-/m1/s1 |
| InChIKey | KNFSKSXAEKXKLN-GNJRFXKQSA-N |
| XLogP | 5.63 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.74 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|