C27H56O6Si2 — CID 102356585
(3R,4R,5S,8S,9S,10S)-11-[tert-butyl(dimethyl)silyl]oxy-5,9-bis(methoxymethoxy)-4,8,10-trimethyl-1-trimethylsilylundec-1-yn-3-ol (PubChem CID 102356585) has the molecular formula C27H56O6Si2 and a molecular weight of 532.91 g/mol. Its IUPAC name is (3R,4R,5S,8S,9S,10S)-11-[tert-butyl(dimethyl)silyl]oxy-5,9-bis(methoxymethoxy)-4,8,10-trimethyl-1-trimethylsilylundec-1-yn-3-ol.
| Compound Name | (3R,4R,5S,8S,9S,10S)-11-[tert-butyl(dimethyl)silyl]oxy-5,9-bis(methoxymethoxy)-4,8,10-trimethyl-1-trimethylsilylundec-1-yn-3-ol |
|---|---|
| PubChem CID | 102356585 |
| Molecular Formula | C27H56O6Si2 |
| Molecular Weight | 532.91 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | (3R,4R,5S,8S,9S,10S)-11-[tert-butyl(dimethyl)silyl]oxy-5,9-bis(methoxymethoxy)-4,8,10-trimethyl-1-trimethylsilylundec-1-yn-3-ol |
| SMILES | COCO[C@@H]([C@@H](C)CC[C@H](OCOC)[C@H](C)[C@@H](O)C#C[Si](C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O6Si2/c1-21(26(32-20-30-8)22(2)18-33-35(12,13)27(4,5)6)14-15-25(31-19-29-7)23(3)24(28)16-17-34(9,10)11/h21-26,28H,14-15,18-20H2,1-13H3/t21-,22-,23+,24-,25-,26-/m0/s1 |
| InChIKey | CVYMDBQLRBDCCS-KHHRQSBUSA-N |
| XLogP | 5.92 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.91 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|