C15H32O3Si2 — CID 102143532
(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylpent-4-yne-1,2-diol (PubChem CID 102143532) has the molecular formula C15H32O3Si2 and a molecular weight of 316.59 g/mol. Its IUPAC name is (2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylpent-4-yne-1,2-diol.
| Compound Name | (2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylpent-4-yne-1,2-diol |
|---|---|
| PubChem CID | 102143532 |
| Molecular Formula | C15H32O3Si2 |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylpent-4-yne-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](C#C[Si](C)(C)C)[C@H](O)CO |
| InChI | InChI=1S/C15H32O3Si2/c1-15(2,3)20(7,8)18-12-13(14(17)11-16)9-10-19(4,5)6/h13-14,16-17H,11-12H2,1-8H3/t13-,14-/m1/s1 |
| InChIKey | OIXGLUPUAIWABA-ZIAGYGMSSA-N |
| XLogP | 2.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|