C20H42O6Si — CID 10001414
(4S,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,7-bis(methoxymethoxy)-2-methylhept-1-en-3-ol (PubChem CID 10001414) has the molecular formula C20H42O6Si and a molecular weight of 406.64 g/mol. Its IUPAC name is (4S,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,7-bis(methoxymethoxy)-2-methylhept-1-en-3-ol.
| Compound Name | (4S,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,7-bis(methoxymethoxy)-2-methylhept-1-en-3-ol |
|---|---|
| PubChem CID | 10001414 |
| Molecular Formula | C20H42O6Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | (4S,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,7-bis(methoxymethoxy)-2-methylhept-1-en-3-ol |
| SMILES | C=C(C)C(O)[C@@H](OCOC)[C@H](CCOCOC)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O6Si/c1-16(2)18(21)19(25-15-23-7)17(10-12-24-14-22-6)11-13-26-27(8,9)20(3,4)5/h17-19,21H,1,10-15H2,2-9H3/t17-,18?,19+/m1/s1 |
| InChIKey | UFYZZAZHOVMRQT-KGNCLDLBSA-N |
| XLogP | 3.95 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|