C21H46O4Si2 — CID 11058851
(4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-(2-trimethylsilylethoxymethoxy)hept-1-en-3-ol (PubChem CID 11058851) has the molecular formula C21H46O4Si2 and a molecular weight of 418.77 g/mol. Its IUPAC name is (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-(2-trimethylsilylethoxymethoxy)hept-1-en-3-ol.
| Compound Name | (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-(2-trimethylsilylethoxymethoxy)hept-1-en-3-ol |
|---|---|
| PubChem CID | 11058851 |
| Molecular Formula | C21H46O4Si2 |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-(2-trimethylsilylethoxymethoxy)hept-1-en-3-ol |
| SMILES | C=C(C)C(O)[C@@H](C)[C@H](CCOCOCC[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H46O4Si2/c1-17(2)20(22)18(3)19(25-27(10,11)21(4,5)6)12-13-23-16-24-14-15-26(7,8)9/h18-20,22H,1,12-16H2,2-11H3/t18-,19-,20?/m0/s1 |
| InChIKey | ALWWOHXYJWCOQK-NFBCFJMWSA-N |
| XLogP | 5.67 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|