C22H46O5Si — CID 10811988
(3R,4R,5R,6R,9S)-1-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5-(methoxymethoxy)-4,6-dimethylundec-10-en-3-ol (PubChem CID 10811988) has the molecular formula C22H46O5Si and a molecular weight of 418.69 g/mol. Its IUPAC name is (3R,4R,5R,6R,9S)-1-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5-(methoxymethoxy)-4,6-dimethylundec-10-en-3-ol.
| Compound Name | (3R,4R,5R,6R,9S)-1-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5-(methoxymethoxy)-4,6-dimethylundec-10-en-3-ol |
|---|---|
| PubChem CID | 10811988 |
| Molecular Formula | C22H46O5Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | (3R,4R,5R,6R,9S)-1-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-5-(methoxymethoxy)-4,6-dimethylundec-10-en-3-ol |
| SMILES | C=C[C@H](CC[C@@H](C)[C@@H](OCOC)[C@H](C)[C@H](O)CCO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C22H46O5Si/c1-11-19(25-8)13-12-17(2)21(26-16-24-7)18(3)20(23)14-15-27-28(9,10)22(4,5)6/h11,17-21,23H,1,12-16H2,2-10H3/t17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | DYLDTETVLBKBEE-PFAUGDHASA-N |
| XLogP | 5.00 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|