C40H81IO5Si2 — CID 11029206
(2S,3S,4R,5R,6S,8Z,10S,11R,12S,13Z)-14-iodo-3-(methoxymethoxy)-2,4,6,8,10,12-hexamethyl-5,11-bis[tri(propan-2-yl)silyloxy]tetradeca-8,13-dien-1-ol (PubChem CID 11029206) has the molecular formula C40H81IO5Si2 and a molecular weight of 825.16 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S,8Z,10S,11R,12S,13Z)-14-iodo-3-(methoxymethoxy)-2,4,6,8,10,12-hexamethyl-5,11-bis[tri(propan-2-yl)silyloxy]tetradeca-8,13-dien-1-ol.
| Compound Name | (2S,3S,4R,5R,6S,8Z,10S,11R,12S,13Z)-14-iodo-3-(methoxymethoxy)-2,4,6,8,10,12-hexamethyl-5,11-bis[tri(propan-2-yl)silyloxy]tetradeca-8,13-dien-1-ol |
|---|---|
| PubChem CID | 11029206 |
| Molecular Formula | C40H81IO5Si2 |
| Molecular Weight | 825.16 g/mol |
| Exact Mass | 824.47 |
| IUPAC Name | (2S,3S,4R,5R,6S,8Z,10S,11R,12S,13Z)-14-iodo-3-(methoxymethoxy)-2,4,6,8,10,12-hexamethyl-5,11-bis[tri(propan-2-yl)silyloxy]tetradeca-8,13-dien-1-ol |
| SMILES | COCO[C@H]([C@@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)/C=C\I)[C@@H](C)CO |
| InChI | InChI=1S/C40H81IO5Si2/c1-26(2)47(27(3)4,28(5)6)45-38(33(14)20-21-41)34(15)22-32(13)23-35(16)40(37(18)39(36(17)24-42)44-25-43-19)46-48(29(7)8,30(9)10)31(11)12/h20-22,26-31,33-40,42H,23-25H2,1-19H3/b21-20-,32-22-/t33-,34-,35-,36-,37+,38-,39-,40+/m0/s1 |
| InChIKey | ISMLRCFJQFWNTE-AKJNATRTSA-N |
| XLogP | 12.55 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.16 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|