C30H64O4Si2 — CID 58762102
(Z)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8,10-pentamethyltridec-11-ene-1,9-diol (PubChem CID 58762102) has the molecular formula C30H64O4Si2 and a molecular weight of 545.01 g/mol. Its IUPAC name is (Z)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8,10-pentamethyltridec-11-ene-1,9-diol.
| Compound Name | (Z)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8,10-pentamethyltridec-11-ene-1,9-diol |
|---|---|
| PubChem CID | 58762102 |
| Molecular Formula | C30H64O4Si2 |
| Molecular Weight | 545.01 g/mol |
| Exact Mass | 544.43 |
| IUPAC Name | (Z)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8,10-pentamethyltridec-11-ene-1,9-diol |
| SMILES | C/C=C\C(C)C(O)C(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)CO |
| InChI | InChI=1S/C30H64O4Si2/c1-17-18-21(2)26(32)25(6)28(34-36(15,16)30(10,11)12)23(4)19-22(3)27(24(5)20-31)33-35(13,14)29(7,8)9/h17-18,21-28,31-32H,19-20H2,1-16H3/b18-17- |
| InChIKey | CZIUZFWWNGANGY-ZCXUNETKSA-N |
| XLogP | 8.27 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.01 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|