C52H112O7Si5 — CID 134970720
(6R,8S,12R,14S,16S)-6,8,12,14-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-10-tri(propan-2-yl)silyloxynonadeca-1,18-diene-4,16-diol (PubChem CID 134970720) has the molecular formula C52H112O7Si5 and a molecular weight of 989.89 g/mol. Its IUPAC name is (6R,8S,12R,14S,16S)-6,8,12,14-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-10-tri(propan-2-yl)silyloxynonadeca-1,18-diene-4,16-diol.
| Compound Name | (6R,8S,12R,14S,16S)-6,8,12,14-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-10-tri(propan-2-yl)silyloxynonadeca-1,18-diene-4,16-diol |
|---|---|
| PubChem CID | 134970720 |
| Molecular Formula | C52H112O7Si5 |
| Molecular Weight | 989.89 g/mol |
| Exact Mass | 988.73 |
| IUPAC Name | (6R,8S,12R,14S,16S)-6,8,12,14-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-10-tri(propan-2-yl)silyloxynonadeca-1,18-diene-4,16-diol |
| SMILES | C=CCC(O)C[C@H](C[C@H](CC(C[C@H](C[C@H](C[C@@H](O)CC=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C52H112O7Si5/c1-29-31-42(53)33-44(55-60(21,22)49(9,10)11)35-46(57-62(25,26)51(15,16)17)37-48(59-64(39(3)4,40(5)6)41(7)8)38-47(58-63(27,28)52(18,19)20)36-45(34-43(54)32-30-2)56-61(23,24)50(12,13)14/h29-30,39-48,53-54H,1-2,31-38H2,3-28H3/t42-,43?,44-,45+,46-,47+,48?/m0/s1 |
| InChIKey | YPMCNMSXWMRHDF-XHQPXSMSSA-N |
| XLogP | 16.32 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.89 |
| LogP ≤ 5 | 16.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|