C23H50O3Si2 — CID 134872746
(3R,4R,5S,6R,7R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7-trimethyloct-1-en-4-ol (PubChem CID 134872746) has the molecular formula C23H50O3Si2 and a molecular weight of 430.82 g/mol. Its IUPAC name is (3R,4R,5S,6R,7R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7-trimethyloct-1-en-4-ol.
| Compound Name | (3R,4R,5S,6R,7R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7-trimethyloct-1-en-4-ol |
|---|---|
| PubChem CID | 134872746 |
| Molecular Formula | C23H50O3Si2 |
| Molecular Weight | 430.82 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (3R,4R,5S,6R,7R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7-trimethyloct-1-en-4-ol |
| SMILES | C=C[C@@H](C)[C@@H](O)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H50O3Si2/c1-15-17(2)20(24)19(4)21(26-28(13,14)23(8,9)10)18(3)16-25-27(11,12)22(5,6)7/h15,17-21,24H,1,16H2,2-14H3/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | BWRNJNMVXSQITO-YMQHIKHWSA-N |
| XLogP | 6.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.82 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|