C28H56O7Si — CID 53473909
(1S,2S,3S,4R)-4-[(4R,5S,6R)-6-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpentane-1,3-diol (PubChem CID 53473909) has the molecular formula C28H56O7Si and a molecular weight of 532.84 g/mol. Its IUPAC name is (1S,2S,3S,4R)-4-[(4R,5S,6R)-6-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpentane-1,3-diol.
| Compound Name | (1S,2S,3S,4R)-4-[(4R,5S,6R)-6-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpentane-1,3-diol |
|---|---|
| PubChem CID | 53473909 |
| Molecular Formula | C28H56O7Si |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | (1S,2S,3S,4R)-4-[(4R,5S,6R)-6-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylpentane-1,3-diol |
| SMILES | C[C@@H]1[C@H]([C@@H](C)[C@H](C)O[Si](C)(C)C(C)(C)C)OC(C)(C)O[C@@H]1[C@H](C)[C@@H](O)[C@H](C)[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C28H56O7Si/c1-16(20(5)35-36(13,14)26(6,7)8)24-19(4)25(34-28(11,12)33-24)18(3)22(29)17(2)23(30)21-15-31-27(9,10)32-21/h16-25,29-30H,15H2,1-14H3/t16-,17-,18+,19+,20-,21+,22-,23-,24-,25+/m0/s1 |
| InChIKey | WINHJRPIWUDQNP-FULWKCJCSA-N |
| XLogP | 5.33 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|