C28H56O5Si2 — CID 11375979
[(1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-yl]methanol (PubChem CID 11375979) has the molecular formula C28H56O5Si2 and a molecular weight of 528.92 g/mol. Its IUPAC name is [(1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-yl]methanol.
| Compound Name | [(1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-yl]methanol |
|---|---|
| PubChem CID | 11375979 |
| Molecular Formula | C28H56O5Si2 |
| Molecular Weight | 528.92 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | [(1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-yl]methanol |
| SMILES | CC(C)[C@H]1O[C@@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C)O[C@@]1(CO)C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C |
| InChI | InChI=1S/C28H56O5Si2/c1-18(2)23-19(3)22(31-34(11,12)25(5,6)7)16-28(30-23)20(4)24(21-15-27(21,17-29)33-28)32-35(13,14)26(8,9)10/h18-24,29H,15-17H2,1-14H3/t19-,20-,21-,22+,23+,24-,27+,28-/m0/s1 |
| InChIKey | AHLNXXXSIPAERW-HISMAMIPSA-N |
| XLogP | 6.96 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.92 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|