C27H54O5Si2 — CID 135056052
tert-butyl-[[(4S,10S,12R)-4,13-dimethyl-8,8-di(propan-2-yl)-7,9,16,17-tetraoxa-8-silatricyclo[10.3.1.11,5]heptadecan-10-yl]methoxy]-dimethylsilane (PubChem CID 135056052) has the molecular formula C27H54O5Si2 and a molecular weight of 514.90 g/mol. Its IUPAC name is tert-butyl-[[(4S,10S,12R)-4,13-dimethyl-8,8-di(propan-2-yl)-7,9,16,17-tetraoxa-8-silatricyclo[10.3.1.11,5]heptadecan-10-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,10S,12R)-4,13-dimethyl-8,8-di(propan-2-yl)-7,9,16,17-tetraoxa-8-silatricyclo[10.3.1.11,5]heptadecan-10-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135056052 |
| Molecular Formula | C27H54O5Si2 |
| Molecular Weight | 514.90 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | tert-butyl-[[(4S,10S,12R)-4,13-dimethyl-8,8-di(propan-2-yl)-7,9,16,17-tetraoxa-8-silatricyclo[10.3.1.11,5]heptadecan-10-yl]methoxy]-dimethylsilane |
| SMILES | CC1CCC23CC[C@H](C)C(CO[Si](C(C)C)(C(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)C[C@H]1O2)O3 |
| InChI | InChI=1S/C27H54O5Si2/c1-19(2)34(20(3)4)29-18-25-22(6)13-15-27(31-25)14-12-21(5)24(30-27)16-23(32-34)17-28-33(10,11)26(7,8)9/h19-25H,12-18H2,1-11H3/t21?,22-,23-,24+,25?,27?/m0/s1 |
| InChIKey | LFYAJKGHLNKWDH-VODRMJAGSA-N |
| XLogP | 7.40 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.90 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|