C29H60O5Si2 — CID 11214911
[(2S,3R,6S,8R,9S)-3-butyl-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]methanol (PubChem CID 11214911) has the molecular formula C29H60O5Si2 and a molecular weight of 544.97 g/mol. Its IUPAC name is [(2S,3R,6S,8R,9S)-3-butyl-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]methanol.
| Compound Name | [(2S,3R,6S,8R,9S)-3-butyl-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]methanol |
|---|---|
| PubChem CID | 11214911 |
| Molecular Formula | C29H60O5Si2 |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 544.40 |
| IUPAC Name | [(2S,3R,6S,8R,9S)-3-butyl-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]methanol |
| SMILES | CCCC[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@]2(CC[C@H](C)[C@@H](CCO[Si](C)(C)C(C)(C)C)O2)O[C@H]1CO |
| InChI | InChI=1S/C29H60O5Si2/c1-13-14-17-28(34-36(11,12)27(6,7)8)19-20-29(33-25(28)22-30)18-15-23(2)24(32-29)16-21-31-35(9,10)26(3,4)5/h23-25,30H,13-22H2,1-12H3/t23-,24+,25-,28+,29-/m0/s1 |
| InChIKey | CZLKEWAEFZWWAH-OFKYEGERSA-N |
| XLogP | 8.03 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|