C26H54O7Si2 — CID 11627979
(4S,5S,6S)-5-[(2S,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4,6-dimethyl-4-triethylsilyloxyoxan-2-ol (PubChem CID 11627979) has the molecular formula C26H54O7Si2 and a molecular weight of 534.88 g/mol. Its IUPAC name is (4S,5S,6S)-5-[(2S,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4,6-dimethyl-4-triethylsilyloxyoxan-2-ol.
| Compound Name | (4S,5S,6S)-5-[(2S,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4,6-dimethyl-4-triethylsilyloxyoxan-2-ol |
|---|---|
| PubChem CID | 11627979 |
| Molecular Formula | C26H54O7Si2 |
| Molecular Weight | 534.88 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | (4S,5S,6S)-5-[(2S,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4,6-dimethyl-4-triethylsilyloxyoxan-2-ol |
| SMILES | CC[Si](CC)(CC)O[C@@]1(C)CC(O)O[C@@H](C)[C@@H]1O[C@H]1C[C@@H](OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O1 |
| InChI | InChI=1S/C26H54O7Si2/c1-13-35(14-2,15-3)33-26(9)17-21(27)29-19(5)24(26)31-22-16-20(28-10)23(18(4)30-22)32-34(11,12)25(6,7)8/h18-24,27H,13-17H2,1-12H3/t18-,19+,20-,21?,22+,23-,24+,26+/m1/s1 |
| InChIKey | GXCIHDIKYORXKH-BLLXRHQWSA-N |
| XLogP | 5.82 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.88 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|