C14H30O5Si — CID 134878312
(2R,3R,4R,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-methyloxane-3,5-diol (PubChem CID 134878312) has the molecular formula C14H30O5Si and a molecular weight of 306.48 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-methyloxane-3,5-diol.
| Compound Name | (2R,3R,4R,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-methyloxane-3,5-diol |
|---|---|
| PubChem CID | 134878312 |
| Molecular Formula | C14H30O5Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2R,3R,4R,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-methyloxane-3,5-diol |
| SMILES | CO[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C14H30O5Si/c1-9-11(15)10(19-13(17-5)12(9)16)8-18-20(6,7)14(2,3)4/h9-13,15-16H,8H2,1-7H3/t9-,10-,11-,12+,13+/m1/s1 |
| InChIKey | ISFUXXLTXCHXAF-KVSVUVNWSA-N |
| XLogP | 1.74 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|