C26H53FO6Si2 — CID 91865616
tert-butyl-[(2R,3R,4R,6S)-6-[(2S,3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,4-dimethyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-dimethylsilane (PubChem CID 91865616) has the molecular formula C26H53FO6Si2 and a molecular weight of 536.87 g/mol. Its IUPAC name is tert-butyl-[(2R,3R,4R,6S)-6-[(2S,3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,4-dimethyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R,4R,6S)-6-[(2S,3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,4-dimethyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 91865616 |
| Molecular Formula | C26H53FO6Si2 |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | tert-butyl-[(2R,3R,4R,6S)-6-[(2S,3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-2,4-dimethyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-dimethylsilane |
| SMILES | CO[C@@H]1C[C@H](O[C@@H]2[C@H](C)O[C@@H](F)C[C@@]2(C)O[Si](C)(C)C(C)(C)C)O[C@H](C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H53FO6Si2/c1-17-22(32-34(11,12)24(3,4)5)19(28-10)15-21(30-17)31-23-18(2)29-20(27)16-26(23,9)33-35(13,14)25(6,7)8/h17-23H,15-16H2,1-14H3/t17-,18+,19-,20-,21+,22-,23-,26-/m1/s1 |
| InChIKey | UGZITNINTCZECI-HXQKQCMISA-N |
| XLogP | 6.80 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|