C20H40O5Si — CID 15981859
[(2S,4R,5R)-5-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4-(oxan-2-yloxy)oxolan-2-yl]methanol (PubChem CID 15981859) has the molecular formula C20H40O5Si and a molecular weight of 388.62 g/mol. Its IUPAC name is [(2S,4R,5R)-5-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4-(oxan-2-yloxy)oxolan-2-yl]methanol.
| Compound Name | [(2S,4R,5R)-5-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4-(oxan-2-yloxy)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 15981859 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [(2S,4R,5R)-5-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4-(oxan-2-yloxy)oxolan-2-yl]methanol |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@H]1O[C@H](CO)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C20H40O5Si/c1-15(14-23-26(5,6)20(2,3)4)11-17-18(12-16(13-21)24-17)25-19-9-7-8-10-22-19/h15-19,21H,7-14H2,1-6H3/t15-,16+,17-,18-,19?/m1/s1 |
| InChIKey | GGOUBRIWROCZJK-DZGDQSPQSA-N |
| XLogP | 4.10 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|