C25H50O10Si — CID 11272660
(2S,3R,5S)-5-[(1R,2R,3R)-2,5-bis(methoxymethoxy)-3-methyl-1-(2-trimethylsilylethoxymethoxy)pentyl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-ol (PubChem CID 11272660) has the molecular formula C25H50O10Si and a molecular weight of 538.75 g/mol. Its IUPAC name is (2S,3R,5S)-5-[(1R,2R,3R)-2,5-bis(methoxymethoxy)-3-methyl-1-(2-trimethylsilylethoxymethoxy)pentyl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-ol.
| Compound Name | (2S,3R,5S)-5-[(1R,2R,3R)-2,5-bis(methoxymethoxy)-3-methyl-1-(2-trimethylsilylethoxymethoxy)pentyl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 11272660 |
| Molecular Formula | C25H50O10Si |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | (2S,3R,5S)-5-[(1R,2R,3R)-2,5-bis(methoxymethoxy)-3-methyl-1-(2-trimethylsilylethoxymethoxy)pentyl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-ol |
| SMILES | COCOCC[C@@H](C)[C@@H](OCOC)[C@H](OCOCC[Si](C)(C)C)[C@@H]1C[C@@H](O)[C@@H]([C@@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C25H50O10Si/c1-18(9-10-29-15-27-4)22(31-16-28-5)24(32-17-30-11-12-36(6,7)8)20-13-19(26)23(34-20)21-14-33-25(2,3)35-21/h18-24,26H,9-17H2,1-8H3/t18-,19-,20+,21+,22-,23+,24-/m1/s1 |
| InChIKey | BEDHLJIOPDEZKM-GCNVISTFSA-N |
| XLogP | 2.99 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|