C29H56O6Si — CID 14704730
(2R)-2-[(4R,5S,6S)-6-[[(2S,5S)-5-[(2R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-yl]methyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propan-1-ol (PubChem CID 14704730) has the molecular formula C29H56O6Si and a molecular weight of 528.85 g/mol. Its IUPAC name is (2R)-2-[(4R,5S,6S)-6-[[(2S,5S)-5-[(2R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-yl]methyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4R,5S,6S)-6-[[(2S,5S)-5-[(2R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-yl]methyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 14704730 |
| Molecular Formula | C29H56O6Si |
| Molecular Weight | 528.85 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | (2R)-2-[(4R,5S,6S)-6-[[(2S,5S)-5-[(2R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-yl]methyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propan-1-ol |
| SMILES | C[C@@H]1[C@@H]([C@H](C)CO)OC(C)(C)O[C@H]1C[C@@H]1CC[C@@](C)([C@H]2CC[C@@](C)([C@@H](C)O[Si](C)(C)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C29H56O6Si/c1-19(18-30)25-20(2)23(32-27(7,8)34-25)17-22-13-15-29(10,31-22)24-14-16-28(9,33-24)21(3)35-36(11,12)26(4,5)6/h19-25,30H,13-18H2,1-12H3/t19-,20+,21-,22+,23+,24-,25-,28+,29+/m1/s1 |
| InChIKey | XVSZRTQUYDALOZ-VCVKFFIUSA-N |
| XLogP | 6.45 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.85 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|