C16H34O6Si — CID 11450963
(2R)-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]propane-1,2-diol (PubChem CID 11450963) has the molecular formula C16H34O6Si and a molecular weight of 350.53 g/mol. Its IUPAC name is (2R)-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]propane-1,2-diol.
| Compound Name | (2R)-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 11450963 |
| Molecular Formula | C16H34O6Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (2R)-2-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]propane-1,2-diol |
| SMILES | C[C@@](O)(CO)[C@@H]1CC[C@@H]([C@](C)(O)COCOCC[Si](C)(C)C)O1 |
| InChI | InChI=1S/C16H34O6Si/c1-15(18,10-17)13-6-7-14(22-13)16(2,19)11-21-12-20-8-9-23(3,4)5/h13-14,17-19H,6-12H2,1-5H3/t13-,14-,15+,16+/m0/s1 |
| InChIKey | NSQHMAPTOWLDMQ-CAOSSQGBSA-N |
| XLogP | 1.36 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|