C23H54O4Si3 — CID 158533030
3-(3-trimethylsilylpropoxy)-2,2-bis(3-trimethylsilylpropoxymethyl)propan-1-ol (PubChem CID 158533030) has the molecular formula C23H54O4Si3 and a molecular weight of 478.94 g/mol. Its IUPAC name is 3-(3-trimethylsilylpropoxy)-2,2-bis(3-trimethylsilylpropoxymethyl)propan-1-ol.
| Compound Name | 3-(3-trimethylsilylpropoxy)-2,2-bis(3-trimethylsilylpropoxymethyl)propan-1-ol |
|---|---|
| PubChem CID | 158533030 |
| Molecular Formula | C23H54O4Si3 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | 3-(3-trimethylsilylpropoxy)-2,2-bis(3-trimethylsilylpropoxymethyl)propan-1-ol |
| SMILES | C[Si](C)(C)CCCOCC(CO)(COCCC[Si](C)(C)C)COCCC[Si](C)(C)C |
| InChI | InChI=1S/C23H54O4Si3/c1-28(2,3)16-10-13-25-20-23(19-24,21-26-14-11-17-29(4,5)6)22-27-15-12-18-30(7,8)9/h24H,10-22H2,1-9H3 |
| InChIKey | VXJRLLXXTMGMGX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|