C14H32O6SiW2 — CID 176610338
2-ethyl-2-(5-trimethoxysilylpentoxymethyl)propane-1,3-diol;tungsten (PubChem CID 176610338) has the molecular formula C14H32O6SiW2 and a molecular weight of 692.17 g/mol. Its IUPAC name is 2-ethyl-2-(5-trimethoxysilylpentoxymethyl)propane-1,3-diol;tungsten.
| Compound Name | 2-ethyl-2-(5-trimethoxysilylpentoxymethyl)propane-1,3-diol;tungsten |
|---|---|
| PubChem CID | 176610338 |
| Molecular Formula | C14H32O6SiW2 |
| Molecular Weight | 692.17 g/mol |
| Exact Mass | 692.10 |
| IUPAC Name | 2-ethyl-2-(5-trimethoxysilylpentoxymethyl)propane-1,3-diol;tungsten |
| SMILES | CCC(CO)(CO)COCCCCC[Si](OC)(OC)OC.[W].[W] |
| InChI | InChI=1S/C14H32O6Si.2W/c1-5-14(11-15,12-16)13-20-9-7-6-8-10-21(17-2,18-3)19-4;;/h15-16H,5-13H2,1-4H3;; |
| InChIKey | VIBRADLKYVYOQF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|