C17H38OSi — CID 123671004
trimethyl-[3-(2,4,4-trimethyl-2-propan-2-ylpentoxy)propyl]silane (PubChem CID 123671004) has the molecular formula C17H38OSi and a molecular weight of 286.58 g/mol. Its IUPAC name is trimethyl-[3-(2,4,4-trimethyl-2-propan-2-ylpentoxy)propyl]silane.
| Compound Name | trimethyl-[3-(2,4,4-trimethyl-2-propan-2-ylpentoxy)propyl]silane |
|---|---|
| PubChem CID | 123671004 |
| Molecular Formula | C17H38OSi |
| Molecular Weight | 286.58 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | trimethyl-[3-(2,4,4-trimethyl-2-propan-2-ylpentoxy)propyl]silane |
| SMILES | CC(C)C(C)(COCCC[Si](C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C17H38OSi/c1-15(2)17(6,13-16(3,4)5)14-18-11-10-12-19(7,8)9/h15H,10-14H2,1-9H3 |
| InChIKey | JTSQWSFPJSKAFT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|