C11H27NSi — CID 106323915
N,2,3-trimethyl-2-(trimethylsilylmethyl)butan-1-amine (PubChem CID 106323915) has the molecular formula C11H27NSi and a molecular weight of 201.43 g/mol. Its IUPAC name is N,2,3-trimethyl-2-(trimethylsilylmethyl)butan-1-amine.
| Compound Name | N,2,3-trimethyl-2-(trimethylsilylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 106323915 |
| Molecular Formula | C11H27NSi |
| Molecular Weight | 201.43 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | N,2,3-trimethyl-2-(trimethylsilylmethyl)butan-1-amine |
| SMILES | CNCC(C)(C[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C11H27NSi/c1-10(2)11(3,8-12-4)9-13(5,6)7/h10,12H,8-9H2,1-7H3 |
| InChIKey | GDYNGXMOBXPXRO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|