C24H48O7Si — CID 100999902
(2R,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-3,5-dimethyl-2-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-4-ol (PubChem CID 100999902) has the molecular formula C24H48O7Si and a molecular weight of 476.73 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-3,5-dimethyl-2-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-4-ol.
| Compound Name | (2R,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-3,5-dimethyl-2-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-4-ol |
|---|---|
| PubChem CID | 100999902 |
| Molecular Formula | C24H48O7Si |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-3,5-dimethyl-2-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-4-ol |
| SMILES | COC[C@@H](C[C@H]1O[C@@](OC)([C@@H]2OC(C)(C)O[C@H]2C)C(C)[C@@H](O)[C@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O7Si/c1-15-19(13-18(14-26-9)31-32(11,12)22(4,5)6)29-24(27-10,16(2)20(15)25)21-17(3)28-23(7,8)30-21/h15-21,25H,13-14H2,1-12H3/t15-,16?,17-,18+,19+,20-,21+,24+/m0/s1 |
| InChIKey | QHVZMTKJEBPDRJ-SOZJVIBUSA-N |
| XLogP | 4.33 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|