C22H45BrO6Si — CID 11092474
(2S,3S,4R,5S,6R)-2-(bromomethyl)-6-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(methoxymethoxy)-5-methyloxan-3-ol (PubChem CID 11092474) has the molecular formula C22H45BrO6Si and a molecular weight of 513.59 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-2-(bromomethyl)-6-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(methoxymethoxy)-5-methyloxan-3-ol.
| Compound Name | (2S,3S,4R,5S,6R)-2-(bromomethyl)-6-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(methoxymethoxy)-5-methyloxan-3-ol |
|---|---|
| PubChem CID | 11092474 |
| Molecular Formula | C22H45BrO6Si |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | (2S,3S,4R,5S,6R)-2-(bromomethyl)-6-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(methoxymethoxy)-5-methyloxan-3-ol |
| SMILES | COCO[C@@H]1[C@@H](C)[C@@H]([C@@H](C)[C@@H](OC)[C@H](C)CO[Si](C)(C)C(C)(C)C)O[C@H](CBr)[C@H]1O |
| InChI | InChI=1S/C22H45BrO6Si/c1-14(12-28-30(9,10)22(4,5)6)19(26-8)15(2)20-16(3)21(27-13-25-7)18(24)17(11-23)29-20/h14-21,24H,11-13H2,1-10H3/t14-,15+,16+,17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | KNAGMGLMUFGVKG-LYWOIHLFSA-N |
| XLogP | 4.44 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|