C32H54O8Si — CID 10952103
[(2R,5S,7S,8R,9S)-7-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-9-(methoxymethoxy)-8-methyl-1,6-dioxaspiro[4.5]decan-2-yl]methyl benzoate (PubChem CID 10952103) has the molecular formula C32H54O8Si and a molecular weight of 594.86 g/mol. Its IUPAC name is [(2R,5S,7S,8R,9S)-7-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-9-(methoxymethoxy)-8-methyl-1,6-dioxaspiro[4.5]decan-2-yl]methyl benzoate.
| Compound Name | [(2R,5S,7S,8R,9S)-7-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-9-(methoxymethoxy)-8-methyl-1,6-dioxaspiro[4.5]decan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10952103 |
| Molecular Formula | C32H54O8Si |
| Molecular Weight | 594.86 g/mol |
| Exact Mass | 594.36 |
| IUPAC Name | [(2R,5S,7S,8R,9S)-7-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-9-(methoxymethoxy)-8-methyl-1,6-dioxaspiro[4.5]decan-2-yl]methyl benzoate |
| SMILES | COCO[C@H]1C[C@@]2(CC[C@H](COC(=O)c3ccccc3)O2)O[C@H]([C@@H](C)[C@@H](OC)[C@H](C)CO[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C32H54O8Si/c1-22(19-38-41(9,10)31(4,5)6)28(35-8)24(3)29-23(2)27(37-21-34-7)18-32(40-29)17-16-26(39-32)20-36-30(33)25-14-12-11-13-15-25/h11-15,22-24,26-29H,16-21H2,1-10H3/t22-,23-,24+,26-,27+,28+,29+,32-/m1/s1 |
| InChIKey | JHMKDJZKXCMCJJ-OSHWCPQESA-N |
| XLogP | 6.44 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.86 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|