C21H34O6Si — CID 18664227
[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxy)oxolan-2-yl]methyl benzoate (PubChem CID 18664227) has the molecular formula C21H34O6Si and a molecular weight of 410.58 g/mol. Its IUPAC name is [(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxy)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxy)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 18664227 |
| Molecular Formula | C21H34O6Si |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxy)oxolan-2-yl]methyl benzoate |
| SMILES | COCCOC1O[C@H](COC(=O)c2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O6Si/c1-21(2,3)28(5,6)27-18-14-17(26-20(18)24-13-12-23-4)15-25-19(22)16-10-8-7-9-11-16/h7-11,17-18,20H,12-15H2,1-6H3/t17-,18+,20?/m0/s1 |
| InChIKey | IFCJAMOBUPEIQR-IVAAQHKWSA-N |
| XLogP | 4.01 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|