C15H22O6 — CID 145051457
[(2R)-5-hydroxyoxolan-2-yl]methyl benzoate;propane-2,2-diol (PubChem CID 145051457) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is [(2R)-5-hydroxyoxolan-2-yl]methyl benzoate;propane-2,2-diol.
| Compound Name | [(2R)-5-hydroxyoxolan-2-yl]methyl benzoate;propane-2,2-diol |
|---|---|
| PubChem CID | 145051457 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [(2R)-5-hydroxyoxolan-2-yl]methyl benzoate;propane-2,2-diol |
| SMILES | CC(C)(O)O.O=C(OC[C@H]1CCC(O)O1)c1ccccc1 |
| InChI | InChI=1S/C12H14O4.C3H8O2/c13-11-7-6-10(16-11)8-15-12(14)9-4-2-1-3-5-9;1-3(2,4)5/h1-5,10-11,13H,6-8H2;4-5H,1-2H3/t10-,11?;/m1./s1 |
| InChIKey | NABZOOMDOBAAAL-QUUNXCOLSA-N |
| XLogP | 1.05 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|