C18H32O6Si — CID 102380500
(4S,4'aR,7'R,8'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-6',6'-dimethylspiro[1,3-dioxolane-4,3'-2,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran]-2-one (PubChem CID 102380500) has the molecular formula C18H32O6Si and a molecular weight of 372.53 g/mol. Its IUPAC name is (4S,4'aR,7'R,8'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-6',6'-dimethylspiro[1,3-dioxolane-4,3'-2,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran]-2-one.
| Compound Name | (4S,4'aR,7'R,8'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-6',6'-dimethylspiro[1,3-dioxolane-4,3'-2,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran]-2-one |
|---|---|
| PubChem CID | 102380500 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (4S,4'aR,7'R,8'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-6',6'-dimethylspiro[1,3-dioxolane-4,3'-2,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran]-2-one |
| SMILES | CC1(C)O[C@@H]2C[C@@]3(COC(=O)O3)CO[C@@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O6Si/c1-16(2,3)25(6,7)24-14-8-12-13(22-17(14,4)5)9-18(10-20-12)11-21-15(19)23-18/h12-14H,8-11H2,1-7H3/t12-,13-,14-,18+/m1/s1 |
| InChIKey | JLOVXOLZPNWJAH-MMQJMDILSA-N |
| XLogP | 3.64 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|