C26H52O6Si2 — CID 11598781
[(2R,4R,5R,6S,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-4-yl] acetate (PubChem CID 11598781) has the molecular formula C26H52O6Si2 and a molecular weight of 516.87 g/mol. Its IUPAC name is [(2R,4R,5R,6S,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-4-yl] acetate.
| Compound Name | [(2R,4R,5R,6S,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-4-yl] acetate |
|---|---|
| PubChem CID | 11598781 |
| Molecular Formula | C26H52O6Si2 |
| Molecular Weight | 516.87 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | [(2R,4R,5R,6S,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](CO[Si](C)(C)C(C)(C)C)O[C@@]2(OCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C)[C@@H]1C |
| InChI | InChI=1S/C26H52O6Si2/c1-18-22(32-34(12,13)25(7,8)9)14-15-28-26(18)19(2)23(30-20(3)27)16-21(31-26)17-29-33(10,11)24(4,5)6/h18-19,21-23H,14-17H2,1-13H3/t18-,19+,21+,22+,23+,26+/m0/s1 |
| InChIKey | AEYNLHRJDWLMHO-OPNRPHIUSA-N |
| XLogP | 6.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.87 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|