C20H34O7Si — CID 102511858
[(1R,3R,8S,11R,14R)-8,13,13-trimethyl-6-oxo-1-trimethylsilyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate (PubChem CID 102511858) has the molecular formula C20H34O7Si and a molecular weight of 414.57 g/mol. Its IUPAC name is [(1R,3R,8S,11R,14R)-8,13,13-trimethyl-6-oxo-1-trimethylsilyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate.
| Compound Name | [(1R,3R,8S,11R,14R)-8,13,13-trimethyl-6-oxo-1-trimethylsilyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate |
|---|---|
| PubChem CID | 102511858 |
| Molecular Formula | C20H34O7Si |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | [(1R,3R,8S,11R,14R)-8,13,13-trimethyl-6-oxo-1-trimethylsilyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2([Si](C)(C)C)O[C@@H]3COC(=O)O[C@@]3(C)CC[C@H]2OC1(C)C |
| InChI | InChI=1S/C20H34O7Si/c1-13(21)24-14-9-11-20(28(5,6)7)15(25-18(14,2)3)8-10-19(4)16(26-20)12-23-17(22)27-19/h14-16H,8-12H2,1-7H3/t14-,15-,16-,19+,20-/m1/s1 |
| InChIKey | QMSGTGDYLXFHDG-DSVUEQLOSA-N |
| XLogP | 3.60 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|