C17H26O7 — CID 102511861
[(1S,3R,8S,11R,14R)-8,13,13-trimethyl-6-oxo-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate (PubChem CID 102511861) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(1S,3R,8S,11R,14R)-8,13,13-trimethyl-6-oxo-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate.
| Compound Name | [(1S,3R,8S,11R,14R)-8,13,13-trimethyl-6-oxo-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate |
|---|---|
| PubChem CID | 102511861 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(1S,3R,8S,11R,14R)-8,13,13-trimethyl-6-oxo-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@H]2O[C@@H]3COC(=O)O[C@@]3(C)CC[C@H]2OC1(C)C |
| InChI | InChI=1S/C17H26O7/c1-10(18)21-13-6-5-11-12(23-16(13,2)3)7-8-17(4)14(22-11)9-20-15(19)24-17/h11-14H,5-9H2,1-4H3/t11-,12+,13+,14+,17-/m0/s1 |
| InChIKey | MTPRRDMEKRSHGY-JQIDMEAISA-N |
| XLogP | 2.35 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |