C20H32O8 — CID 102511853
[(1S,3R,4S,7R,10R)-4,10-diacetyloxy-1,9,9-trimethyl-2,8-dioxabicyclo[5.5.0]dodecan-3-yl]methyl acetate (PubChem CID 102511853) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is [(1S,3R,4S,7R,10R)-4,10-diacetyloxy-1,9,9-trimethyl-2,8-dioxabicyclo[5.5.0]dodecan-3-yl]methyl acetate.
| Compound Name | [(1S,3R,4S,7R,10R)-4,10-diacetyloxy-1,9,9-trimethyl-2,8-dioxabicyclo[5.5.0]dodecan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 102511853 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [(1S,3R,4S,7R,10R)-4,10-diacetyloxy-1,9,9-trimethyl-2,8-dioxabicyclo[5.5.0]dodecan-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@]2(C)CC[C@@H](OC(C)=O)C(C)(C)O[C@@H]2CC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H32O8/c1-12(21)24-11-16-15(25-13(2)22)7-8-18-20(6,27-16)10-9-17(26-14(3)23)19(4,5)28-18/h15-18H,7-11H2,1-6H3/t15-,16+,17+,18+,20-/m0/s1 |
| InChIKey | KNNBVNQQOCTUTB-ZIVNCQHPSA-N |
| XLogP | 2.31 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|