C20H32O10 — CID 56616718
[(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-7,7-dimethyloctyl] acetate (PubChem CID 56616718) has the molecular formula C20H32O10 and a molecular weight of 432.47 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-7,7-dimethyloctyl] acetate.
| Compound Name | [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-7,7-dimethyloctyl] acetate |
|---|---|
| PubChem CID | 56616718 |
| Molecular Formula | C20H32O10 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-7,7-dimethyloctyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](CC(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C20H32O10/c1-11(21)26-10-17(28-13(3)23)19(30-15(5)25)18(29-14(4)24)16(27-12(2)22)9-20(6,7)8/h16-19H,9-10H2,1-8H3/t16-,17+,18+,19+/m0/s1 |
| InChIKey | ZPJDIQYDEAPQBS-WJFTUGDTSA-N |
| XLogP | 1.71 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|