C18H28O9 — CID 58743771
[3,4,5-triacetyloxy-6-(2-methylpropyl)oxan-2-yl]methyl acetate (PubChem CID 58743771) has the molecular formula C18H28O9 and a molecular weight of 388.41 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(2-methylpropyl)oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(2-methylpropyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58743771 |
| Molecular Formula | C18H28O9 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(2-methylpropyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(CC(C)C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H28O9/c1-9(2)7-14-16(24-11(4)20)18(26-13(6)22)17(25-12(5)21)15(27-14)8-23-10(3)19/h9,14-18H,7-8H2,1-6H3 |
| InChIKey | JTQJFPTUJRWBGB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|