C17H23FO11 — CID 11058920
[(3S,4S,5R,6R)-3,4,5-triacetyloxy-2-(acetyloxymethyl)-6-fluorooxan-2-yl]methyl acetate (PubChem CID 11058920) has the molecular formula C17H23FO11 and a molecular weight of 422.36 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-3,4,5-triacetyloxy-2-(acetyloxymethyl)-6-fluorooxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,5R,6R)-3,4,5-triacetyloxy-2-(acetyloxymethyl)-6-fluorooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11058920 |
| Molecular Formula | C17H23FO11 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | [(3S,4S,5R,6R)-3,4,5-triacetyloxy-2-(acetyloxymethyl)-6-fluorooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1(COC(C)=O)O[C@H](F)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H23FO11/c1-8(19)24-6-17(7-25-9(2)20)15(28-12(5)23)13(26-10(3)21)14(16(18)29-17)27-11(4)22/h13-16H,6-7H2,1-5H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | LGVFWRUKQJNXFB-WCVJEAGWSA-N |
| XLogP | -0.03 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|