C17H26O8 — CID 91063704
[(1S,2S,3R,4R)-2,3,4-triacetyloxycyclooctyl]methyl acetate (PubChem CID 91063704) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-2,3,4-triacetyloxycyclooctyl]methyl acetate.
| Compound Name | [(1S,2S,3R,4R)-2,3,4-triacetyloxycyclooctyl]methyl acetate |
|---|---|
| PubChem CID | 91063704 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [(1S,2S,3R,4R)-2,3,4-triacetyloxycyclooctyl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CCCC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H26O8/c1-10(18)22-9-14-7-5-6-8-15(23-11(2)19)17(25-13(4)21)16(14)24-12(3)20/h14-17H,5-9H2,1-4H3/t14-,15+,16-,17+/m0/s1 |
| InChIKey | AFGKKJFABRCEMG-VVLHAWIVSA-N |
| XLogP | 1.53 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|