C16H24O8 — CID 139069736
[(1R,2S,5R,6S)-2,5,6-triacetyloxycyclooctyl] acetate (PubChem CID 139069736) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is [(1R,2S,5R,6S)-2,5,6-triacetyloxycyclooctyl] acetate.
| Compound Name | [(1R,2S,5R,6S)-2,5,6-triacetyloxycyclooctyl] acetate |
|---|---|
| PubChem CID | 139069736 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [(1R,2S,5R,6S)-2,5,6-triacetyloxycyclooctyl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H24O8/c1-9(17)21-13-5-6-15(23-11(3)19)16(24-12(4)20)8-7-14(13)22-10(2)18/h13-16H,5-8H2,1-4H3/t13-,14+,15+,16- |
| InChIKey | DXXHJZMNLISNKN-SYMSYNOKSA-N |
| XLogP | 1.29 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|