C16H26O10 — CID 15608032
[(2S,3R,4S,5R)-3,4,5-triacetyloxy-2,6-dimethoxyhexyl] acetate (PubChem CID 15608032) has the molecular formula C16H26O10 and a molecular weight of 378.37 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3,4,5-triacetyloxy-2,6-dimethoxyhexyl] acetate.
| Compound Name | [(2S,3R,4S,5R)-3,4,5-triacetyloxy-2,6-dimethoxyhexyl] acetate |
|---|---|
| PubChem CID | 15608032 |
| Molecular Formula | C16H26O10 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [(2S,3R,4S,5R)-3,4,5-triacetyloxy-2,6-dimethoxyhexyl] acetate |
| SMILES | COC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H](COC(C)=O)OC |
| InChI | InChI=1S/C16H26O10/c1-9(17)23-8-13(22-6)15(25-11(3)19)16(26-12(4)20)14(7-21-5)24-10(2)18/h13-16H,7-8H2,1-6H3/t13-,14+,15+,16-/m0/s1 |
| InChIKey | UZCWYWPMTQZNMH-JJXSEGSLSA-N |
| XLogP | 0.01 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|