C28H46O12 — CID 538926
(3,7,9,11,13-pentaacetyloxy-4,8,12-trimethyltridecyl) acetate (PubChem CID 538926) has the molecular formula C28H46O12 and a molecular weight of 574.66 g/mol. Its IUPAC name is (3,7,9,11,13-pentaacetyloxy-4,8,12-trimethyltridecyl) acetate.
| Compound Name | (3,7,9,11,13-pentaacetyloxy-4,8,12-trimethyltridecyl) acetate |
|---|---|
| PubChem CID | 538926 |
| Molecular Formula | C28H46O12 |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | (3,7,9,11,13-pentaacetyloxy-4,8,12-trimethyltridecyl) acetate |
| SMILES | CC(=O)OCCC(OC(C)=O)C(C)CCC(OC(C)=O)C(C)C(CC(OC(C)=O)C(C)COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C28H46O12/c1-16(25(37-21(6)31)12-13-35-19(4)29)10-11-26(38-22(7)32)18(3)28(40-24(9)34)14-27(39-23(8)33)17(2)15-36-20(5)30/h16-18,25-28H,10-15H2,1-9H3 |
| InChIKey | GYOSRSDOZMRABT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|