C18H28O8 — CID 12966562
[(3aR,4R,6S,9R,9aS)-4,6-diacetyloxy-2,2-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-9-yl]methyl acetate (PubChem CID 12966562) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is [(3aR,4R,6S,9R,9aS)-4,6-diacetyloxy-2,2-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-9-yl]methyl acetate.
| Compound Name | [(3aR,4R,6S,9R,9aS)-4,6-diacetyloxy-2,2-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-9-yl]methyl acetate |
|---|---|
| PubChem CID | 12966562 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | [(3aR,4R,6S,9R,9aS)-4,6-diacetyloxy-2,2-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-9-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CC[C@H](OC(C)=O)C[C@@H](OC(C)=O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H28O8/c1-10(19)22-9-13-6-7-14(23-11(2)20)8-15(24-12(3)21)17-16(13)25-18(4,5)26-17/h13-17H,6-9H2,1-5H3/t13-,14+,15-,16+,17-/m1/s1 |
| InChIKey | YUNWDTYFCZSZNW-BPKGMFCQSA-N |
| XLogP | 1.73 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|