C23H38O8 — CID 134835974
2-[(2R,5S,9R)-2-butyl-2-[(1R)-1,2-diacetyloxyethyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]ethyl acetate (PubChem CID 134835974) has the molecular formula C23H38O8 and a molecular weight of 442.55 g/mol. Its IUPAC name is 2-[(2R,5S,9R)-2-butyl-2-[(1R)-1,2-diacetyloxyethyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]ethyl acetate.
| Compound Name | 2-[(2R,5S,9R)-2-butyl-2-[(1R)-1,2-diacetyloxyethyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]ethyl acetate |
|---|---|
| PubChem CID | 134835974 |
| Molecular Formula | C23H38O8 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-[(2R,5S,9R)-2-butyl-2-[(1R)-1,2-diacetyloxyethyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]ethyl acetate |
| SMILES | CCCC[C@]1([C@@H](COC(C)=O)OC(C)=O)CC[C@]2(CCC(C)[C@@H](CCOC(C)=O)O2)O1 |
| InChI | InChI=1S/C23H38O8/c1-6-7-10-22(21(29-19(5)26)15-28-18(4)25)12-13-23(31-22)11-8-16(2)20(30-23)9-14-27-17(3)24/h16,20-21H,6-15H2,1-5H3/t16?,20-,21-,22-,23+/m1/s1 |
| InChIKey | ANFNIFHUCHGPHN-QJENMLJCSA-N |
| XLogP | 3.69 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|