C27H40O15 — CID 101344740
[(2S,3R,4S,6R)-3-acetyloxy-6-ethoxy-4-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]oxan-2-yl]methyl acetate (PubChem CID 101344740) has the molecular formula C27H40O15 and a molecular weight of 604.60 g/mol. Its IUPAC name is [(2S,3R,4S,6R)-3-acetyloxy-6-ethoxy-4-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,6R)-3-acetyloxy-6-ethoxy-4-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101344740 |
| Molecular Formula | C27H40O15 |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | [(2S,3R,4S,6R)-3-acetyloxy-6-ethoxy-4-[[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]oxan-2-yl]methyl acetate |
| SMILES | CCO[C@H]1C[C@H](C[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@@H](OC(C)=O)[C@H](COC(C)=O)O1 |
| InChI | InChI=1S/C27H40O15/c1-8-34-23-10-19(24(37-15(4)30)21(42-23)11-35-13(2)28)9-20-25(38-16(5)31)27(40-18(7)33)26(39-17(6)32)22(41-20)12-36-14(3)29/h19-27H,8-12H2,1-7H3/t19-,20+,21-,22+,23+,24+,25-,26+,27+/m0/s1 |
| InChIKey | OVJAGCKGVFYSRL-KKPMZRTJSA-N |
| XLogP | 0.76 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|