C28H48O10 — CID 162988109
[(2R,3R,4S,5R,6R)-5-acetyloxy-2-(acetyloxymethyl)-4-[(2R)-2-methylbutanoyl]oxy-6-octoxyoxan-3-yl] (2R)-2-methylbutanoate (PubChem CID 162988109) has the molecular formula C28H48O10 and a molecular weight of 544.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-5-acetyloxy-2-(acetyloxymethyl)-4-[(2R)-2-methylbutanoyl]oxy-6-octoxyoxan-3-yl] (2R)-2-methylbutanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-5-acetyloxy-2-(acetyloxymethyl)-4-[(2R)-2-methylbutanoyl]oxy-6-octoxyoxan-3-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 162988109 |
| Molecular Formula | C28H48O10 |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-5-acetyloxy-2-(acetyloxymethyl)-4-[(2R)-2-methylbutanoyl]oxy-6-octoxyoxan-3-yl] (2R)-2-methylbutanoate |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(=O)[C@H](C)CC)[C@H](OC(=O)[C@H](C)CC)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H48O10/c1-8-11-12-13-14-15-16-33-28-25(35-21(7)30)24(38-27(32)19(5)10-3)23(37-26(31)18(4)9-2)22(36-28)17-34-20(6)29/h18-19,22-25,28H,8-17H2,1-7H3/t18-,19-,22-,23-,24+,25-,28-/m1/s1 |
| InChIKey | JQZJQFWBPIOHOB-IPHSUNGOSA-N |
| XLogP | 4.50 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|