C27H38O18 — CID 14540190
[2,3,4,5,6,7,8-heptaacetyloxy-5-(acetyloxymethyl)octyl] acetate (PubChem CID 14540190) has the molecular formula C27H38O18 and a molecular weight of 650.58 g/mol. Its IUPAC name is [2,3,4,5,6,7,8-heptaacetyloxy-5-(acetyloxymethyl)octyl] acetate.
| Compound Name | [2,3,4,5,6,7,8-heptaacetyloxy-5-(acetyloxymethyl)octyl] acetate |
|---|---|
| PubChem CID | 14540190 |
| Molecular Formula | C27H38O18 |
| Molecular Weight | 650.58 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | [2,3,4,5,6,7,8-heptaacetyloxy-5-(acetyloxymethyl)octyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C27H38O18/c1-13(28)37-10-22(40-16(4)31)24(42-18(6)33)26(44-20(8)35)27(45-21(9)36,12-39-15(3)30)25(43-19(7)34)23(41-17(5)32)11-38-14(2)29/h22-26H,10-12H2,1-9H3 |
| InChIKey | UULWAYGYEQIWDW-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 236.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.58 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|