C24H38O12 — CID 540666
(3,5,7,9,11-pentaacetyloxy-10-methylundecyl) acetate (PubChem CID 540666) has the molecular formula C24H38O12 and a molecular weight of 518.56 g/mol. Its IUPAC name is (3,5,7,9,11-pentaacetyloxy-10-methylundecyl) acetate.
| Compound Name | (3,5,7,9,11-pentaacetyloxy-10-methylundecyl) acetate |
|---|---|
| PubChem CID | 540666 |
| Molecular Formula | C24H38O12 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | (3,5,7,9,11-pentaacetyloxy-10-methylundecyl) acetate |
| SMILES | CC(=O)OCCC(CC(CC(CC(OC(C)=O)C(C)COC(C)=O)OC(C)=O)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C24H38O12/c1-14(13-32-16(3)26)24(36-20(7)30)12-23(35-19(6)29)11-22(34-18(5)28)10-21(33-17(4)27)8-9-31-15(2)25/h14,21-24H,8-13H2,1-7H3 |
| InChIKey | ILUSEYGLXOBMSZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|